C15H15BrSi — CID 58352081
3-bromo-5,5,7-trimethylbenzo[b][1]benzosilole (PubChem CID 58352081) has the molecular formula C15H15BrSi and a molecular weight of 303.28 g/mol. Its IUPAC name is 3-bromo-5,5,7-trimethylbenzo[b][1]benzosilole.
| Compound Name | 3-bromo-5,5,7-trimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 58352081 |
| Molecular Formula | C15H15BrSi |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 3-bromo-5,5,7-trimethylbenzo[b][1]benzosilole |
| SMILES | Cc1ccc2c(c1)[Si](C)(C)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C15H15BrSi/c1-10-4-6-12-13-7-5-11(16)9-15(13)17(2,3)14(12)8-10/h4-9H,1-3H3 |
| InChIKey | RYEFXPXJYCZKQM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|