C20H28Si2 — CID 171731157
3,5,5,6,6,7,7-heptamethylbenzo[d][1,3]benzodisilepine (PubChem CID 171731157) has the molecular formula C20H28Si2 and a molecular weight of 324.62 g/mol. Its IUPAC name is 3,5,5,6,6,7,7-heptamethylbenzo[d][1,3]benzodisilepine.
| Compound Name | 3,5,5,6,6,7,7-heptamethylbenzo[d][1,3]benzodisilepine |
|---|---|
| PubChem CID | 171731157 |
| Molecular Formula | C20H28Si2 |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3,5,5,6,6,7,7-heptamethylbenzo[d][1,3]benzodisilepine |
| SMILES | Cc1ccc2c(c1)[Si](C)(C)C(C)(C)[Si](C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C20H28Si2/c1-15-12-13-17-16-10-8-9-11-18(16)21(4,5)20(2,3)22(6,7)19(17)14-15/h8-14H,1-7H3 |
| InChIKey | BSIRINBUTXRQRY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|