C23H24Si — CID 102487155
(5S)-5-tert-butyl-3-methyl-5-phenylbenzo[b][1]benzosilole (PubChem CID 102487155) has the molecular formula C23H24Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (5S)-5-tert-butyl-3-methyl-5-phenylbenzo[b][1]benzosilole.
| Compound Name | (5S)-5-tert-butyl-3-methyl-5-phenylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 102487155 |
| Molecular Formula | C23H24Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (5S)-5-tert-butyl-3-methyl-5-phenylbenzo[b][1]benzosilole |
| SMILES | Cc1ccc2c(c1)[Si@](c1ccccc1)(C(C)(C)C)c1ccccc1-2 |
| InChI | InChI=1S/C23H24Si/c1-17-14-15-20-19-12-8-9-13-21(19)24(22(20)16-17,23(2,3)4)18-10-6-5-7-11-18/h5-16H,1-4H3/t24-/m1/s1 |
| InChIKey | WRKGEEMVGKYEGV-XMMPIXPASA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|