C26H24OSi — CID 101484245
6-tert-butyl-6-phenylnaphtho[1,2-c][2,1]benzoxasiline (PubChem CID 101484245) has the molecular formula C26H24OSi and a molecular weight of 380.56 g/mol. Its IUPAC name is 6-tert-butyl-6-phenylnaphtho[1,2-c][2,1]benzoxasiline.
| Compound Name | 6-tert-butyl-6-phenylnaphtho[1,2-c][2,1]benzoxasiline |
|---|---|
| PubChem CID | 101484245 |
| Molecular Formula | C26H24OSi |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 6-tert-butyl-6-phenylnaphtho[1,2-c][2,1]benzoxasiline |
| SMILES | CC(C)(C)[Si]1(c2ccccc2)Oc2c(ccc3ccccc23)-c2ccccc21 |
| InChI | InChI=1S/C26H24OSi/c1-26(2,3)28(20-12-5-4-6-13-20)24-16-10-9-15-22(24)23-18-17-19-11-7-8-14-21(19)25(23)27-28/h4-18H,1-3H3 |
| InChIKey | YCMOZOKVVPOOIJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|