C28H30O2Si — CID 86213074
13,13-ditert-butyl-12,14-dioxa-13-silapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 86213074) has the molecular formula C28H30O2Si and a molecular weight of 426.63 g/mol. Its IUPAC name is 13,13-ditert-butyl-12,14-dioxa-13-silapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13,13-ditert-butyl-12,14-dioxa-13-silapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 86213074 |
| Molecular Formula | C28H30O2Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 13,13-ditert-butyl-12,14-dioxa-13-silapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C28H30O2Si/c1-27(2,3)31(28(4,5)6)29-23-17-15-19-11-7-9-13-21(19)25(23)26-22-14-10-8-12-20(22)16-18-24(26)30-31/h7-18H,1-6H3 |
| InChIKey | ASGZLYIKHWEIBN-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|