C24H24OSi2 — CID 15784606
12,12,14,14-tetramethyl-13-oxa-12,14-disilapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 15784606) has the molecular formula C24H24OSi2 and a molecular weight of 384.63 g/mol. Its IUPAC name is 12,12,14,14-tetramethyl-13-oxa-12,14-disilapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 12,12,14,14-tetramethyl-13-oxa-12,14-disilapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 15784606 |
| Molecular Formula | C24H24OSi2 |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 12,12,14,14-tetramethyl-13-oxa-12,14-disilapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | C[Si]1(C)O[Si](C)(C)c2ccc3ccccc3c2-c2c1ccc1ccccc21 |
| InChI | InChI=1S/C24H24OSi2/c1-26(2)21-15-13-17-9-5-7-11-19(17)23(21)24-20-12-8-6-10-18(20)14-16-22(24)27(3,4)25-26/h5-16H,1-4H3 |
| InChIKey | XAYSAJLNWWPCQN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|