C60H48O4Si4 — CID 169094040
2,4,6,8-tetramethyl-2,4,6,8-tetra(phenanthren-1-yl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 169094040) has the molecular formula C60H48O4Si4 and a molecular weight of 945.38 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6,8-tetra(phenanthren-1-yl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6,8-tetra(phenanthren-1-yl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 169094040 |
| Molecular Formula | C60H48O4Si4 |
| Molecular Weight | 945.38 g/mol |
| Exact Mass | 944.26 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6,8-tetra(phenanthren-1-yl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(c2cccc3c2ccc2ccccc23)O[Si](C)(c2cccc3c2ccc2ccccc23)O[Si](C)(c2cccc3c2ccc2ccccc23)O[Si](C)(c2cccc3c2ccc2ccccc23)O1 |
| InChI | InChI=1S/C60H48O4Si4/c1-65(57-29-13-25-49-45-21-9-5-17-41(45)33-37-53(49)57)61-66(2,58-30-14-26-50-46-22-10-6-18-42(46)34-38-54(50)58)63-68(4,60-32-16-28-52-48-24-12-8-20-44(48)36-40-56(52)60)64-67(3,62-65)59-31-15-27-51-47-23-11-7-19-43(47)35-39-55(51)59/h5-40H,1-4H3 |
| InChIKey | ZOJGXBBILCCIDJ-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.38 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|