C55H50O5Si5 — CID 169094038
2,4,6,8,10-pentamethyl-2,4,6,8,10-pentanaphthalen-1-yl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 169094038) has the molecular formula C55H50O5Si5 and a molecular weight of 931.43 g/mol. Its IUPAC name is 2,4,6,8,10-pentamethyl-2,4,6,8,10-pentanaphthalen-1-yl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentamethyl-2,4,6,8,10-pentanaphthalen-1-yl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 169094038 |
| Molecular Formula | C55H50O5Si5 |
| Molecular Weight | 931.43 g/mol |
| Exact Mass | 930.25 |
| IUPAC Name | 2,4,6,8,10-pentamethyl-2,4,6,8,10-pentanaphthalen-1-yl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | C[Si]1(c2cccc3ccccc23)O[Si](C)(c2cccc3ccccc23)O[Si](C)(c2cccc3ccccc23)O[Si](C)(c2cccc3ccccc23)O[Si](C)(c2cccc3ccccc23)O1 |
| InChI | InChI=1S/C55H50O5Si5/c1-61(51-36-16-26-41-21-6-11-31-46(41)51)56-62(2,52-37-17-27-42-22-7-12-32-47(42)52)58-64(4,54-39-19-29-44-24-9-14-34-49(44)54)60-65(5,55-40-20-30-45-25-10-15-35-50(45)55)59-63(3,57-61)53-38-18-28-43-23-8-13-33-48(43)53/h6-40H,1-5H3 |
| InChIKey | SNDAJGGVERDZFL-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.43 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|