C24H34Si — CID 15400630
4-tert-butyl-1-(2-methylbut-3-en-2-yl)-1-naphthalen-1-ylsilinane (PubChem CID 15400630) has the molecular formula C24H34Si and a molecular weight of 350.62 g/mol. Its IUPAC name is 4-tert-butyl-1-(2-methylbut-3-en-2-yl)-1-naphthalen-1-ylsilinane.
| Compound Name | 4-tert-butyl-1-(2-methylbut-3-en-2-yl)-1-naphthalen-1-ylsilinane |
|---|---|
| PubChem CID | 15400630 |
| Molecular Formula | C24H34Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 4-tert-butyl-1-(2-methylbut-3-en-2-yl)-1-naphthalen-1-ylsilinane |
| SMILES | C=CC(C)(C)[Si]1(c2cccc3ccccc23)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C24H34Si/c1-7-24(5,6)25(17-15-20(16-18-25)23(2,3)4)22-14-10-12-19-11-8-9-13-21(19)22/h7-14,20H,1,15-18H2,2-6H3 |
| InChIKey | COMGICUAFFZYTN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|