C20H35N — CID 144654857
N-benzyl-4-tert-butyl-N-methylcyclohexan-1-amine;ethane (PubChem CID 144654857) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-benzyl-4-tert-butyl-N-methylcyclohexan-1-amine;ethane.
| Compound Name | N-benzyl-4-tert-butyl-N-methylcyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 144654857 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-benzyl-4-tert-butyl-N-methylcyclohexan-1-amine;ethane |
| SMILES | CC.CN(Cc1ccccc1)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H29N.C2H6/c1-18(2,3)16-10-12-17(13-11-16)19(4)14-15-8-6-5-7-9-15;1-2/h5-9,16-17H,10-14H2,1-4H3;1-2H3 |
| InChIKey | VXAUJOIIOJMEPF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |