C16H28N2 — CID 142272680
N-benzyl-N,1-dimethylpiperidin-3-amine;ethane (PubChem CID 142272680) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-benzyl-N,1-dimethylpiperidin-3-amine;ethane.
| Compound Name | N-benzyl-N,1-dimethylpiperidin-3-amine;ethane |
|---|---|
| PubChem CID | 142272680 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-benzyl-N,1-dimethylpiperidin-3-amine;ethane |
| SMILES | CC.CN1CCCC(N(C)Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H22N2.C2H6/c1-15-10-6-9-14(12-15)16(2)11-13-7-4-3-5-8-13;1-2/h3-5,7-8,14H,6,9-12H2,1-2H3;1-2H3 |
| InChIKey | CKTQRWOCFFQGHT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |