C17H22N2O — CID 42508292
1-[(3R)-3-[benzyl(methyl)amino]piperidin-1-yl]but-2-yn-1-one (PubChem CID 42508292) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-[(3R)-3-[benzyl(methyl)amino]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(3R)-3-[benzyl(methyl)amino]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 42508292 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-[(3R)-3-[benzyl(methyl)amino]piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC[C@@H](N(C)Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H22N2O/c1-3-8-17(20)19-12-7-11-16(14-19)18(2)13-15-9-5-4-6-10-15/h4-6,9-10,16H,7,11-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | NFZKPDKLOYJVPP-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|