C17H22N4OS — CID 45206682
[3-[benzyl(methyl)amino]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 45206682) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is [3-[benzyl(methyl)amino]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [3-[benzyl(methyl)amino]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 45206682 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [3-[benzyl(methyl)amino]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCCC(N(C)Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H22N4OS/c1-13-16(23-19-18-13)17(22)21-10-6-9-15(12-21)20(2)11-14-7-4-3-5-8-14/h3-5,7-8,15H,6,9-12H2,1-2H3 |
| InChIKey | RMZYRMQLPVVICF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |