C21H15O2PSe — CID 122363158
13-methyl-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 122363158) has the molecular formula C21H15O2PSe and a molecular weight of 409.28 g/mol. Its IUPAC name is 13-methyl-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13-methyl-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 122363158 |
| Molecular Formula | C21H15O2PSe |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 13-methyl-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | CP1(=[Se])Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C21H15O2PSe/c1-24(25)22-18-12-10-14-6-2-4-8-16(14)20(18)21-17-9-5-3-7-15(17)11-13-19(21)23-24/h2-13H,1H3 |
| InChIKey | QHGZAPHPLPWCRU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|