C27H26NO3PS — CID 11431466
13-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (PubChem CID 11431466) has the molecular formula C27H26NO3PS and a molecular weight of 475.55 g/mol. Its IUPAC name is 13-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
| Compound Name | 13-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 11431466 |
| Molecular Formula | C27H26NO3PS |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 13-(2,2,5,5-tetramethyl-1,3-thiazolidin-4-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| SMILES | CC1(C)NC(P2(=O)Oc3ccc4ccccc4c3-c3c(ccc4ccccc34)O2)C(C)(C)S1 |
| InChI | InChI=1S/C27H26NO3PS/c1-26(2)25(28-27(3,4)33-26)32(29)30-21-15-13-17-9-5-7-11-19(17)23(21)24-20-12-8-6-10-18(20)14-16-22(24)31-32/h5-16,25,28H,1-4H3 |
| InChIKey | BXXBLNJLDBDXET-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|