C20H13O4PS — CID 134129656
Dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin, 4-hydroxy-, 4-oxide,(11bS)- (PubChem CID 134129656) has the molecular formula C20H13O4PS and a molecular weight of 380.36 g/mol.
| Compound Name | Dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin, 4-hydroxy-, 4-oxide,(11bS)- |
|---|---|
| PubChem CID | 134129656 |
| Molecular Formula | C20H13O4PS |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | — |
| SMILES | O=P1(O)Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1.[S] |
| InChI | InChI=1S/C20H13O4P.S/c21-25(22)23-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)24-25;/h1-12H,(H,21,22); |
| InChIKey | ATGZKJQOQJMJTB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|