C32H22O4P2 — CID 122371953
(13-hydroxy-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl)-diphenylphosphane (PubChem CID 122371953) has the molecular formula C32H22O4P2 and a molecular weight of 532.47 g/mol. Its IUPAC name is (13-hydroxy-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl)-diphenylphosphane.
| Compound Name | (13-hydroxy-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 122371953 |
| Molecular Formula | C32H22O4P2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | (13-hydroxy-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl)-diphenylphosphane |
| SMILES | O=P1(O)Oc2ccc3ccccc3c2-c2c(c(P(c3ccccc3)c3ccccc3)cc3ccccc23)O1 |
| InChI | InChI=1S/C32H22O4P2/c33-38(34)35-28-20-19-22-11-7-9-17-26(22)30(28)31-27-18-10-8-12-23(27)21-29(32(31)36-38)37(24-13-3-1-4-14-24)25-15-5-2-6-16-25/h1-21H,(H,33,34) |
| InChIKey | CVELSLOHZFVXKP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|