C42H29O6P — CID 101461300
13-hydroxy-10,16-bis(2-methoxynaphthalen-1-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaene 13-oxide (PubChem CID 101461300) has the molecular formula C42H29O6P and a molecular weight of 660.66 g/mol. Its IUPAC name is 13-hydroxy-10,16-bis(2-methoxynaphthalen-1-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaene 13-oxide.
| Compound Name | 13-hydroxy-10,16-bis(2-methoxynaphthalen-1-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaene 13-oxide |
|---|---|
| PubChem CID | 101461300 |
| Molecular Formula | C42H29O6P |
| Molecular Weight | 660.66 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | 13-hydroxy-10,16-bis(2-methoxynaphthalen-1-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaene 13-oxide |
| SMILES | COc1ccc2ccccc2c1-c1c2c(cc3ccccc13)-c1cc3ccccc3c(-c3c(OC)ccc4ccccc34)c1OP(=O)(O)O2 |
| InChI | InChI=1S/C42H29O6P/c1-45-35-21-19-25-11-3-7-15-29(25)37(35)39-31-17-9-5-13-27(31)23-33-34-24-28-14-6-10-18-32(28)40(42(34)48-49(43,44)47-41(33)39)38-30-16-8-4-12-26(30)20-22-36(38)46-2/h3-24H,1-2H3,(H,43,44) |
| InChIKey | XLBYHBSDCGQBBL-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.66 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|