C34H25O4P — CID 23110717
13-hydroxy-10,16-bis(4-methylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (PubChem CID 23110717) has the molecular formula C34H25O4P and a molecular weight of 528.54 g/mol. Its IUPAC name is 13-hydroxy-10,16-bis(4-methylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
| Compound Name | 13-hydroxy-10,16-bis(4-methylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 23110717 |
| Molecular Formula | C34H25O4P |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 13-hydroxy-10,16-bis(4-methylphenyl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| SMILES | Cc1ccc(-c2cc3ccccc3c3c2OP(=O)(O)Oc2c(-c4ccc(C)cc4)cc4ccccc4c2-3)cc1 |
| InChI | InChI=1S/C34H25O4P/c1-21-11-15-23(16-12-21)29-19-25-7-3-5-9-27(25)31-32-28-10-6-4-8-26(28)20-30(24-17-13-22(2)14-18-24)34(32)38-39(35,36)37-33(29)31/h3-20H,1-2H3,(H,35,36) |
| InChIKey | CYFOVKZNOCUXMV-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|