C34H17F6N2O8P — CID 102435257
13-hydroxy-10,16-bis[4-nitro-3-(trifluoromethyl)phenyl]-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (PubChem CID 102435257) has the molecular formula C34H17F6N2O8P and a molecular weight of 726.48 g/mol. Its IUPAC name is 13-hydroxy-10,16-bis[4-nitro-3-(trifluoromethyl)phenyl]-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
| Compound Name | 13-hydroxy-10,16-bis[4-nitro-3-(trifluoromethyl)phenyl]-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 102435257 |
| Molecular Formula | C34H17F6N2O8P |
| Molecular Weight | 726.48 g/mol |
| Exact Mass | 726.06 |
| IUPAC Name | 13-hydroxy-10,16-bis[4-nitro-3-(trifluoromethyl)phenyl]-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3ccccc3c3c2OP(=O)(O)Oc2c(-c4ccc([N+](=O)[O-])c(C(F)(F)F)c4)cc4ccccc4c2-3)cc1C(F)(F)F |
| InChI | InChI=1S/C34H17F6N2O8P/c35-33(36,37)25-15-19(9-11-27(25)41(43)44)23-13-17-5-1-3-7-21(17)29-30-22-8-4-2-6-18(22)14-24(32(30)50-51(47,48)49-31(23)29)20-10-12-28(42(45)46)26(16-20)34(38,39)40/h1-16H,(H,47,48) |
| InChIKey | DGJOFAXRAQYLFI-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.48 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|