C24H18F3NO2 — CID 135024724
1,1-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-phenylindene (PubChem CID 135024724) has the molecular formula C24H18F3NO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 1,1-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-phenylindene.
| Compound Name | 1,1-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-phenylindene |
|---|---|
| PubChem CID | 135024724 |
| Molecular Formula | C24H18F3NO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1,1-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-phenylindene |
| SMILES | CC1(C)C(c2ccccc2)=C(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C24H18F3NO2/c1-23(2)18-11-7-6-10-17(18)21(22(23)15-8-4-3-5-9-15)16-12-13-20(28(29)30)19(14-16)24(25,26)27/h3-14H,1-2H3 |
| InChIKey | HYQHQQDARMZXMX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|