C11H10F3NO4 — CID 11536412
2-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-1,3-dioxolane (PubChem CID 11536412) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is 2-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-1,3-dioxolane.
| Compound Name | 2-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11536412 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-1,3-dioxolane |
| SMILES | CC1(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)OCCO1 |
| InChI | InChI=1S/C11H10F3NO4/c1-10(18-4-5-19-10)7-2-3-9(15(16)17)8(6-7)11(12,13)14/h2-3,6H,4-5H2,1H3 |
| InChIKey | XVJGKGWRDQJZEP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|