C16H13F2NO5 — CID 10246442
2-[3-(2,4-difluorophenoxy)-4-nitrophenyl]-2-methyl-1,3-dioxolane (PubChem CID 10246442) has the molecular formula C16H13F2NO5 and a molecular weight of 337.28 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenoxy)-4-nitrophenyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[3-(2,4-difluorophenoxy)-4-nitrophenyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10246442 |
| Molecular Formula | C16H13F2NO5 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[3-(2,4-difluorophenoxy)-4-nitrophenyl]-2-methyl-1,3-dioxolane |
| SMILES | CC1(c2ccc([N+](=O)[O-])c(Oc3ccc(F)cc3F)c2)OCCO1 |
| InChI | InChI=1S/C16H13F2NO5/c1-16(22-6-7-23-16)10-2-4-13(19(20)21)15(8-10)24-14-5-3-11(17)9-12(14)18/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | CFXSVKAGISHFRU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|