C15H13FN2O3 — CID 62378003
8-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 62378003) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 8-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 62378003 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 8-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | O=[N+]([O-])c1ccc(F)cc1Oc1cccc2c1NCCC2 |
| InChI | InChI=1S/C15H13FN2O3/c16-11-6-7-12(18(19)20)14(9-11)21-13-5-1-3-10-4-2-8-17-15(10)13/h1,3,5-7,9,17H,2,4,8H2 |
| InChIKey | KSYNQWRAZKLCNE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|