C15H14N2O3 — CID 61025966
8-(3-nitrophenoxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 61025966) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 8-(3-nitrophenoxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-(3-nitrophenoxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 61025966 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 8-(3-nitrophenoxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | O=[N+]([O-])c1cccc(Oc2cccc3c2NCCC3)c1 |
| InChI | InChI=1S/C15H14N2O3/c18-17(19)12-6-2-7-13(10-12)20-14-8-1-4-11-5-3-9-16-15(11)14/h1-2,4,6-8,10,16H,3,5,9H2 |
| InChIKey | QNRGKGWBXVJAMX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|