C14H16FNO5 — CID 58421665
8-(5-fluoro-2-nitrophenoxy)-1,4-dioxaspiro[4.5]decane (PubChem CID 58421665) has the molecular formula C14H16FNO5 and a molecular weight of 297.28 g/mol. Its IUPAC name is 8-(5-fluoro-2-nitrophenoxy)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-(5-fluoro-2-nitrophenoxy)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 58421665 |
| Molecular Formula | C14H16FNO5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 8-(5-fluoro-2-nitrophenoxy)-1,4-dioxaspiro[4.5]decane |
| SMILES | O=[N+]([O-])c1ccc(F)cc1OC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H16FNO5/c15-10-1-2-12(16(17)18)13(9-10)21-11-3-5-14(6-4-11)19-7-8-20-14/h1-2,9,11H,3-8H2 |
| InChIKey | AAOKQBYBPFLTTB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|