C14H17FN2O4 — CID 43685316
N-(4-fluoro-2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 43685316) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is N-(4-fluoro-2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(4-fluoro-2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 43685316 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(4-fluoro-2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H17FN2O4/c15-10-1-2-12(13(9-10)17(18)19)16-11-3-5-14(6-4-11)20-7-8-21-14/h1-2,9,11,16H,3-8H2 |
| InChIKey | PQHZERWGEUKOOG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|