C15H19N3O5 — CID 97259594
4-[[(8R)-1,4-dioxaspiro[4.4]nonan-8-yl]amino]-N-methyl-3-nitrobenzamide (PubChem CID 97259594) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is 4-[[(8R)-1,4-dioxaspiro[4.4]nonan-8-yl]amino]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[[(8R)-1,4-dioxaspiro[4.4]nonan-8-yl]amino]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 97259594 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-[[(8R)-1,4-dioxaspiro[4.4]nonan-8-yl]amino]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(N[C@@H]2CCC3(C2)OCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N3O5/c1-16-14(19)10-2-3-12(13(8-10)18(20)21)17-11-4-5-15(9-11)22-6-7-23-15/h2-3,8,11,17H,4-7,9H2,1H3,(H,16,19)/t11-/m1/s1 |
| InChIKey | GRTGXVKSYUOJRY-LLVKDONJSA-N |
| XLogP | 1.66 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|