C17H25N3O3 — CID 18144595
1-[3-nitro-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]phenyl]ethanone (PubChem CID 18144595) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[3-nitro-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]phenyl]ethanone.
| Compound Name | 1-[3-nitro-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 18144595 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[3-nitro-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(NC2CC(C)(C)NC(C)(C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25N3O3/c1-11(21)12-6-7-14(15(8-12)20(22)23)18-13-9-16(2,3)19-17(4,5)10-13/h6-8,13,18-19H,9-10H2,1-5H3 |
| InChIKey | IWMFNOXVBRGXAM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|