C16H23FN2O2 — CID 115998709
4-fluoro-2-nitro-N-(3,3,5,5-tetramethylcyclohexyl)aniline (PubChem CID 115998709) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-fluoro-2-nitro-N-(3,3,5,5-tetramethylcyclohexyl)aniline.
| Compound Name | 4-fluoro-2-nitro-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 115998709 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-fluoro-2-nitro-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
| SMILES | CC1(C)CC(Nc2ccc(F)cc2[N+](=O)[O-])CC(C)(C)C1 |
| InChI | InChI=1S/C16H23FN2O2/c1-15(2)8-12(9-16(3,4)10-15)18-13-6-5-11(17)7-14(13)19(20)21/h5-7,12,18H,8-10H2,1-4H3 |
| InChIKey | XIXSLHFGTLIKNM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|