C16H21FN2O2 — CID 115400499
(1R,4S)-N-(4-fluoro-2-nitrophenyl)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-amine (PubChem CID 115400499) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is (1R,4S)-N-(4-fluoro-2-nitrophenyl)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,4S)-N-(4-fluoro-2-nitrophenyl)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 115400499 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (1R,4S)-N-(4-fluoro-2-nitrophenyl)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CC1(C)C(Nc2ccc(F)cc2[N+](=O)[O-])[C@]2(C)CC[C@H]1C2 |
| InChI | InChI=1S/C16H21FN2O2/c1-15(2)10-6-7-16(3,9-10)14(15)18-12-5-4-11(17)8-13(12)19(20)21/h4-5,8,10,14,18H,6-7,9H2,1-3H3/t10-,14?,16+/m0/s1 |
| InChIKey | XRCVTZIXBGXJIY-KDLAOUEFSA-N |
| XLogP | 4.36 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|