C8H10FN3O2 — CID 114449270
2-(4-fluoro-2-nitrophenyl)-1,1-dimethylhydrazine (PubChem CID 114449270) has the molecular formula C8H10FN3O2 and a molecular weight of 199.19 g/mol. Its IUPAC name is 2-(4-fluoro-2-nitrophenyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(4-fluoro-2-nitrophenyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 114449270 |
| Molecular Formula | C8H10FN3O2 |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(4-fluoro-2-nitrophenyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10FN3O2/c1-11(2)10-7-4-3-6(9)5-8(7)12(13)14/h3-5,10H,1-2H3 |
| InChIKey | UAZWTOXNYGPEQF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|