C9H11N3O3 — CID 83107477
4-(2,2-dimethylhydrazinyl)-3-nitrobenzaldehyde (PubChem CID 83107477) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-3-nitrobenzaldehyde.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 83107477 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-3-nitrobenzaldehyde |
| SMILES | CN(C)Nc1ccc(C=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O3/c1-11(2)10-8-4-3-7(6-13)5-9(8)12(14)15/h3-6,10H,1-2H3 |
| InChIKey | GYACRZJNHGUZMS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|