C10H12N2O5 — CID 83108306
4-(1,3-dihydroxypropan-2-ylamino)-3-nitrobenzaldehyde (PubChem CID 83108306) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 4-(1,3-dihydroxypropan-2-ylamino)-3-nitrobenzaldehyde.
| Compound Name | 4-(1,3-dihydroxypropan-2-ylamino)-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 83108306 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-(1,3-dihydroxypropan-2-ylamino)-3-nitrobenzaldehyde |
| SMILES | O=Cc1ccc(NC(CO)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12N2O5/c13-4-7-1-2-9(10(3-7)12(16)17)11-8(5-14)6-15/h1-4,8,11,14-15H,5-6H2 |
| InChIKey | ZTQQSRRZAUVPMZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|