C13H20FN3O2 — CID 115594916
1-N,1-N-diethyl-2-N-(4-fluoro-2-nitrophenyl)propane-1,2-diamine (PubChem CID 115594916) has the molecular formula C13H20FN3O2 and a molecular weight of 269.32 g/mol. Its IUPAC name is 1-N,1-N-diethyl-2-N-(4-fluoro-2-nitrophenyl)propane-1,2-diamine.
| Compound Name | 1-N,1-N-diethyl-2-N-(4-fluoro-2-nitrophenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115594916 |
| Molecular Formula | C13H20FN3O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-N,1-N-diethyl-2-N-(4-fluoro-2-nitrophenyl)propane-1,2-diamine |
| SMILES | CCN(CC)CC(C)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20FN3O2/c1-4-16(5-2)9-10(3)15-12-7-6-11(14)8-13(12)17(18)19/h6-8,10,15H,4-5,9H2,1-3H3 |
| InChIKey | CUMHQNMQWRJVQP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|