C15H24FN3O2 — CID 115569605
1-N,1-N-diethyl-4-N-(4-fluoro-2-nitrophenyl)pentane-1,4-diamine (PubChem CID 115569605) has the molecular formula C15H24FN3O2 and a molecular weight of 297.37 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(4-fluoro-2-nitrophenyl)pentane-1,4-diamine.
| Compound Name | 1-N,1-N-diethyl-4-N-(4-fluoro-2-nitrophenyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 115569605 |
| Molecular Formula | C15H24FN3O2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(4-fluoro-2-nitrophenyl)pentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H24FN3O2/c1-4-18(5-2)10-6-7-12(3)17-14-9-8-13(16)11-15(14)19(20)21/h8-9,11-12,17H,4-7,10H2,1-3H3 |
| InChIKey | VMPKSMOXAHYLQN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|