C10H12FN3O2 — CID 43599343
1-N-(4-fluoro-2-nitrophenyl)cyclobutane-1,3-diamine (PubChem CID 43599343) has the molecular formula C10H12FN3O2 and a molecular weight of 225.22 g/mol. Its IUPAC name is 1-N-(4-fluoro-2-nitrophenyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(4-fluoro-2-nitrophenyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 43599343 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-N-(4-fluoro-2-nitrophenyl)cyclobutane-1,3-diamine |
| SMILES | NC1CC(Nc2ccc(F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C10H12FN3O2/c11-6-1-2-9(10(3-6)14(15)16)13-8-4-7(12)5-8/h1-3,7-8,13H,4-5,12H2 |
| InChIKey | OHBKAYOWEDRHSU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|