C16H23N3O5S — CID 60503058
1-[3-nitro-4-[(1-propylsulfonylpiperidin-4-yl)amino]phenyl]ethanone (PubChem CID 60503058) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[3-nitro-4-[(1-propylsulfonylpiperidin-4-yl)amino]phenyl]ethanone.
| Compound Name | 1-[3-nitro-4-[(1-propylsulfonylpiperidin-4-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 60503058 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[3-nitro-4-[(1-propylsulfonylpiperidin-4-yl)amino]phenyl]ethanone |
| SMILES | CCCS(=O)(=O)N1CCC(Nc2ccc(C(C)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H23N3O5S/c1-3-10-25(23,24)18-8-6-14(7-9-18)17-15-5-4-13(12(2)20)11-16(15)19(21)22/h4-5,11,14,17H,3,6-10H2,1-2H3 |
| InChIKey | GQODAXVFAZROOE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|