C13H18N4O5S — CID 24592331
4-[(1-methylsulfonylpiperidin-4-yl)amino]-3-nitrobenzamide (PubChem CID 24592331) has the molecular formula C13H18N4O5S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-[(1-methylsulfonylpiperidin-4-yl)amino]-3-nitrobenzamide.
| Compound Name | 4-[(1-methylsulfonylpiperidin-4-yl)amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24592331 |
| Molecular Formula | C13H18N4O5S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 4-[(1-methylsulfonylpiperidin-4-yl)amino]-3-nitrobenzamide |
| SMILES | CS(=O)(=O)N1CCC(Nc2ccc(C(N)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H18N4O5S/c1-23(21,22)16-6-4-10(5-7-16)15-11-3-2-9(13(14)18)8-12(11)17(19)20/h2-3,8,10,15H,4-7H2,1H3,(H2,14,18) |
| InChIKey | OOUUIYZTJMYQHD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|