C12H12FNO5 — CID 129116227
(3aR,6R)-6-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 129116227) has the molecular formula C12H12FNO5 and a molecular weight of 269.23 g/mol. Its IUPAC name is (3aR,6R)-6-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3aR,6R)-6-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 129116227 |
| Molecular Formula | C12H12FNO5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (3aR,6R)-6-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | O=[N+]([O-])c1ccc(F)cc1O[C@@H]1CO[C@@H]2CCOC21 |
| InChI | InChI=1S/C12H12FNO5/c13-7-1-2-8(14(15)16)10(5-7)19-11-6-18-9-3-4-17-12(9)11/h1-2,5,9,11-12H,3-4,6H2/t9-,11-,12?/m1/s1 |
| InChIKey | CCZZYRVYMZCVNQ-DFWSTUSTSA-N |
| XLogP | 1.67 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|