C12H14FNO3 — CID 118167573
2-[[(3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroaniline (PubChem CID 118167573) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-[[(3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroaniline.
| Compound Name | 2-[[(3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroaniline |
|---|---|
| PubChem CID | 118167573 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-[[(3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1O[C@@H]1CO[C@@H]2CCO[C@H]21 |
| InChI | InChI=1S/C12H14FNO3/c13-7-1-2-8(14)10(5-7)17-11-6-16-9-3-4-15-12(9)11/h1-2,5,9,11-12H,3-4,6,14H2/t9-,11-,12-/m1/s1 |
| InChIKey | KYXVUDOAJGFOHT-YUSALJHKSA-N |
| XLogP | 1.34 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|