C26H28FN3O4S — CID 146696476
[4-[[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]methyl]-5-methylquinazolin-7-yl]imino-cyclopropyl-methyl-oxo-λ6-sulfane (PubChem CID 146696476) has the molecular formula C26H28FN3O4S and a molecular weight of 497.59 g/mol. Its IUPAC name is [4-[[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]methyl]-5-methylquinazolin-7-yl]imino-cyclopropyl-methyl-oxo-λ6-sulfane.
| Compound Name | [4-[[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]methyl]-5-methylquinazolin-7-yl]imino-cyclopropyl-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 146696476 |
| Molecular Formula | C26H28FN3O4S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [4-[[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]methyl]-5-methylquinazolin-7-yl]imino-cyclopropyl-methyl-oxo-λ6-sulfane |
| SMILES | Cc1cc(N=S(C)(=O)C2CC2)cc2ncnc(Cc3ccc(F)cc3O[C@@H]3CO[C@@H]4CCO[C@@H]43)c12 |
| InChI | InChI=1S/C26H28FN3O4S/c1-15-9-18(30-35(2,31)19-5-6-19)12-21-25(15)20(28-14-29-21)10-16-3-4-17(27)11-23(16)34-24-13-33-22-7-8-32-26(22)24/h3-4,9,11-12,14,19,22,24,26H,5-8,10,13H2,1-2H3/t22-,24-,26+,35?/m1/s1 |
| InChIKey | QPCSOMPWIHIGON-LDUIWUTNSA-N |
| XLogP | 4.49 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |