C24H26FN3O5S — CID 159316491
(3S,3aR,6R,6aR)-6-[2-[[7-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-5-methylquinazolin-4-yl]methyl]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 159316491) has the molecular formula C24H26FN3O5S and a molecular weight of 487.55 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-6-[2-[[7-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-5-methylquinazolin-4-yl]methyl]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S,3aR,6R,6aR)-6-[2-[[7-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-5-methylquinazolin-4-yl]methyl]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 159316491 |
| Molecular Formula | C24H26FN3O5S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (3S,3aR,6R,6aR)-6-[2-[[7-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-5-methylquinazolin-4-yl]methyl]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | Cc1cc(N=S(C)(C)=O)cc2ncnc(Cc3ccc(F)cc3O[C@@H]3CO[C@H]4[C@@H]3OC[C@@H]4O)c12 |
| InChI | InChI=1S/C24H26FN3O5S/c1-13-6-16(28-34(2,3)30)9-18-22(13)17(26-12-27-18)7-14-4-5-15(25)8-20(14)33-21-11-32-23-19(29)10-31-24(21)23/h4-6,8-9,12,19,21,23-24,29H,7,10-11H2,1-3H3/t19-,21+,23+,24+/m0/s1 |
| InChIKey | LDEXDLZKVLBHBH-IVGWJTKZSA-N |
| XLogP | 2.93 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |