C26H29FN4O5S — CID 139397097
N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methyl-7-(1,4-oxathian-4-ylideneamino)quinazolin-4-amine (PubChem CID 139397097) has the molecular formula C26H29FN4O5S and a molecular weight of 528.61 g/mol. Its IUPAC name is N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methyl-7-(1,4-oxathian-4-ylideneamino)quinazolin-4-amine.
| Compound Name | N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methyl-7-(1,4-oxathian-4-ylideneamino)quinazolin-4-amine |
|---|---|
| PubChem CID | 139397097 |
| Molecular Formula | C26H29FN4O5S |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methyl-7-(1,4-oxathian-4-ylideneamino)quinazolin-4-amine |
| SMILES | COc1c(N=S2CCOCC2)cc2ncnc(Nc3ccc(F)cc3OC3CO[C@@H]4CCO[C@H]34)c2c1C |
| InChI | InChI=1S/C26H29FN4O5S/c1-15-23-18(12-19(24(15)32-2)31-37-9-7-33-8-10-37)28-14-29-26(23)30-17-4-3-16(27)11-21(17)36-22-13-35-20-5-6-34-25(20)22/h3-4,11-12,14,20,22,25H,5-10,13H2,1-2H3,(H,28,29,30)/t20-,22?,25+/m1/s1 |
| InChIKey | SEWGOELRSQZDOD-NSULSOORSA-N |
| XLogP | 4.23 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |