C24H26FN3O4 — CID 123197780
N-[2-[(3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-4-fluorophenyl]-5,7-dimethylquinazolin-4-amine (PubChem CID 123197780) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[2-[(3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-4-fluorophenyl]-5,7-dimethylquinazolin-4-amine.
| Compound Name | N-[2-[(3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-4-fluorophenyl]-5,7-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 123197780 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[2-[(3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-4-fluorophenyl]-5,7-dimethylquinazolin-4-amine |
| SMILES | CCOC1COC2C(Oc3cc(F)ccc3Nc3ncnc4cc(C)cc(C)c34)COC12 |
| InChI | InChI=1S/C24H26FN3O4/c1-4-29-19-10-30-23-20(11-31-22(19)23)32-18-9-15(25)5-6-16(18)28-24-21-14(3)7-13(2)8-17(21)26-12-27-24/h5-9,12,19-20,22-23H,4,10-11H2,1-3H3,(H,26,27,28) |
| InChIKey | DGFSGOSCNHNYFH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |