C27H31FN4O5S — CID 90140538
N-[2-[[(3R,3aR,6R,6aR)-3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine (PubChem CID 90140538) has the molecular formula C27H31FN4O5S and a molecular weight of 542.63 g/mol. Its IUPAC name is N-[2-[[(3R,3aR,6R,6aR)-3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine.
| Compound Name | N-[2-[[(3R,3aR,6R,6aR)-3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
|---|---|
| PubChem CID | 90140538 |
| Molecular Formula | C27H31FN4O5S |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | N-[2-[[(3R,3aR,6R,6aR)-3-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
| SMILES | CCO[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1cc(F)ccc1Nc1ncnc2cc(N=S3(=O)CCCC3)cc(C)c12 |
| InChI | InChI=1S/C27H31FN4O5S/c1-3-34-22-13-35-26-23(14-36-25(22)26)37-21-11-17(28)6-7-19(21)31-27-24-16(2)10-18(12-20(24)29-15-30-27)32-38(33)8-4-5-9-38/h6-7,10-12,15,22-23,25-26H,3-5,8-9,13-14H2,1-2H3,(H,29,30,31)/t22-,23-,25-,26-/m1/s1 |
| InChIKey | LJCVUJARPJQRPC-OQUNMALSSA-N |
| XLogP | 4.66 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |