C26H28ClFN4O6S — CID 139397217
N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine (PubChem CID 139397217) has the molecular formula C26H28ClFN4O6S and a molecular weight of 579.05 g/mol. Its IUPAC name is N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine.
| Compound Name | N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
|---|---|
| PubChem CID | 139397217 |
| Molecular Formula | C26H28ClFN4O6S |
| Molecular Weight | 579.05 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
| SMILES | COc1c(N=S2(=O)CCCC2)cc2ncnc(Nc3ccc(F)cc3OC3CO[C@@H]4C(OC)CO[C@H]34)c2c1Cl |
| InChI | InChI=1S/C26H28ClFN4O6S/c1-34-19-11-36-25-20(12-37-24(19)25)38-18-9-14(28)5-6-15(18)31-26-21-16(29-13-30-26)10-17(23(35-2)22(21)27)32-39(33)7-3-4-8-39/h5-6,9-10,13,19-20,24-25H,3-4,7-8,11-12H2,1-2H3,(H,29,30,31)/t19?,20?,24-,25-/m1/s1 |
| InChIKey | GZFDUIXPOANTDN-LTBUFCQKSA-N |
| XLogP | 4.63 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.05 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |