C23H25FN4O5 — CID 144956164
4-N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methylquinazoline-4,7-diamine (PubChem CID 144956164) has the molecular formula C23H25FN4O5 and a molecular weight of 456.47 g/mol. Its IUPAC name is 4-N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methylquinazoline-4,7-diamine.
| Compound Name | 4-N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methylquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 144956164 |
| Molecular Formula | C23H25FN4O5 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-N-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-6-methoxy-5-methylquinazoline-4,7-diamine |
| SMILES | COc1c(N)cc2ncnc(Nc3ccc(F)cc3OC3CO[C@@H]4C(OC)CO[C@H]34)c2c1C |
| InChI | InChI=1S/C23H25FN4O5/c1-11-19-15(7-13(25)20(11)30-3)26-10-27-23(19)28-14-5-4-12(24)6-16(14)33-18-9-32-21-17(29-2)8-31-22(18)21/h4-7,10,17-18,21-22H,8-9,25H2,1-3H3,(H,26,27,28)/t17?,18?,21-,22-/m1/s1 |
| InChIKey | PCVOBNOZTWZALG-ODMAOCJESA-N |
| XLogP | 2.97 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|