C22H22F2N4O4S — CID 129116256
(6R)-6-[2-[[7-[(dimethyl-λ4-sulfanylidene)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 129116256) has the molecular formula C22H22F2N4O4S and a molecular weight of 476.51 g/mol. Its IUPAC name is (6R)-6-[2-[[7-[(dimethyl-λ4-sulfanylidene)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (6R)-6-[2-[[7-[(dimethyl-λ4-sulfanylidene)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 129116256 |
| Molecular Formula | C22H22F2N4O4S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (6R)-6-[2-[[7-[(dimethyl-λ4-sulfanylidene)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CS(C)=Nc1cc(F)c2c(Nc3ccc(F)cc3O[C@@H]3COC4C(O)COC43)ncnc2c1 |
| InChI | InChI=1S/C22H22F2N4O4S/c1-33(2)28-12-6-13(24)19-15(7-12)25-10-26-22(19)27-14-4-3-11(23)5-17(14)32-18-9-31-20-16(29)8-30-21(18)20/h3-7,10,16,18,20-21,29H,8-9H2,1-2H3,(H,25,26,27)/t16?,18-,20?,21?/m1/s1 |
| InChIKey | JHGHARFZFVJYDV-XBWKUFBFSA-N |
| XLogP | 3.25 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |