C22H22F2IN3O4S — CID 144854915
(3S,4S)-4-[5-fluoro-2-[[5-fluoro-7-[(1-oxothiolan-1-ylidene)-λ3-iodanyl]quinazolin-4-yl]amino]phenoxy]oxolan-3-ol (PubChem CID 144854915) has the molecular formula C22H22F2IN3O4S and a molecular weight of 589.40 g/mol. Its IUPAC name is (3S,4S)-4-[5-fluoro-2-[[5-fluoro-7-[(1-oxothiolan-1-ylidene)-λ3-iodanyl]quinazolin-4-yl]amino]phenoxy]oxolan-3-ol.
| Compound Name | (3S,4S)-4-[5-fluoro-2-[[5-fluoro-7-[(1-oxothiolan-1-ylidene)-λ3-iodanyl]quinazolin-4-yl]amino]phenoxy]oxolan-3-ol |
|---|---|
| PubChem CID | 144854915 |
| Molecular Formula | C22H22F2IN3O4S |
| Molecular Weight | 589.40 g/mol |
| Exact Mass | 589.03 |
| IUPAC Name | (3S,4S)-4-[5-fluoro-2-[[5-fluoro-7-[(1-oxothiolan-1-ylidene)-λ3-iodanyl]quinazolin-4-yl]amino]phenoxy]oxolan-3-ol |
| SMILES | O=S1(=Ic2cc(F)c3c(Nc4ccc(F)cc4O[C@H]4COC[C@@H]4O)ncnc3c2)CCCC1 |
| InChI | InChI=1S/C22H22F2IN3O4S/c23-13-3-4-16(19(7-13)32-20-11-31-10-18(20)29)28-22-21-15(24)8-14(9-17(21)26-12-27-22)25-33(30)5-1-2-6-33/h3-4,7-9,12,18,20,29H,1-2,5-6,10-11H2,(H,26,27,28)/t18-,20-/m0/s1 |
| InChIKey | GJDHULCGMDHCRL-ICSRJNTNSA-N |
| XLogP | 3.92 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|